C13H21OP — CID 102232293
(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)-prop-2-enoxyphosphane (PubChem CID 102232293) has the molecular formula C13H21OP and a molecular weight of 224.28 g/mol. Its IUPAC name is (1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)-prop-2-enoxyphosphane.
| Compound Name | (1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)-prop-2-enoxyphosphane |
|---|---|
| PubChem CID | 102232293 |
| Molecular Formula | C13H21OP |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | (1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)-prop-2-enoxyphosphane |
| SMILES | C=CCOPC1(C)C(C)=C(C)C(C)=C1C |
| InChI | InChI=1S/C13H21OP/c1-7-8-14-15-13(6)11(4)9(2)10(3)12(13)5/h7,15H,1,8H2,2-6H3 |
| InChIKey | UNBGUFATWHVNMN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|