C34H37BN2 — CID 102232378
[4-[1,1-bis(1H-pyrrol-2-yl)ethyl]phenyl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 102232378) has the molecular formula C34H37BN2 and a molecular weight of 484.50 g/mol. Its IUPAC name is [4-[1,1-bis(1H-pyrrol-2-yl)ethyl]phenyl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [4-[1,1-bis(1H-pyrrol-2-yl)ethyl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 102232378 |
| Molecular Formula | C34H37BN2 |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | [4-[1,1-bis(1H-pyrrol-2-yl)ethyl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2ccc(C(C)(c3ccc[nH]3)c3ccc[nH]3)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C34H37BN2/c1-22-18-24(3)32(25(4)19-22)35(33-26(5)20-23(2)21-27(33)6)29-14-12-28(13-15-29)34(7,30-10-8-16-36-30)31-11-9-17-37-31/h8-21,36-37H,1-7H3 |
| InChIKey | GJWJPDQGZGNCPA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|