C27H39NO2 — CID 10223249
2-[(dimethylamino)methyl]-1-(4-pentylphenyl)-4-phenylmethoxycyclohexan-1-ol (PubChem CID 10223249) has the molecular formula C27H39NO2 and a molecular weight of 409.61 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-1-(4-pentylphenyl)-4-phenylmethoxycyclohexan-1-ol.
| Compound Name | 2-[(dimethylamino)methyl]-1-(4-pentylphenyl)-4-phenylmethoxycyclohexan-1-ol |
|---|---|
| PubChem CID | 10223249 |
| Molecular Formula | C27H39NO2 |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | 2-[(dimethylamino)methyl]-1-(4-pentylphenyl)-4-phenylmethoxycyclohexan-1-ol |
| SMILES | CCCCCc1ccc(C2(O)CCC(OCc3ccccc3)CC2CN(C)C)cc1 |
| InChI | InChI=1S/C27H39NO2/c1-4-5-7-10-22-13-15-24(16-14-22)27(29)18-17-26(19-25(27)20-28(2)3)30-21-23-11-8-6-9-12-23/h6,8-9,11-16,25-26,29H,4-5,7,10,17-21H2,1-3H3 |
| InChIKey | VCUAUFHHJYCCAA-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|