About 4-[[1-methyl-2,4-dioxo-6-(2-phenylethynyl)quinazolin-3-yl]methyl]benzoic acid
4-[[1-methyl-2,4-dioxo-6-(2-phenylethynyl)quinazolin-3-yl]methyl]benzoic acid (PubChem CID 10223270) has the molecular formula C25H18N2O4
and a molecular weight of 410.43 g/mol. Its IUPAC name is 4-[[1-methyl-2,4-dioxo-6-(2-phenylethynyl)quinazolin-3-yl]methyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[[1-methyl-2,4-dioxo-6-(2-phenylethynyl)quinazolin-3-yl]methyl]benzoic acid |
| PubChem CID | 10223270 |
| Molecular Formula | C25H18N2O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 4-[[1-methyl-2,4-dioxo-6-(2-phenylethynyl)quinazolin-3-yl]methyl]benzoic acid |
| SMILES | Cn1c(=O)n(Cc2ccc(C(=O)O)cc2)c(=O)c2cc(C#Cc3ccccc3)ccc21 |
| InChI | InChI=1S/C25H18N2O4/c1-26-22-14-11-18(8-7-17-5-3-2-4-6-17)15-21(22)23(28)27(25(26)31)16-19-9-12-20(13-10-19)24(29)30/h2-6,9-15H,16H2,1H3,(H,29,30) |
| InChIKey | QQKVWHSHKQNMLP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[[1-methyl-2,4-dioxo-6-(2-phenylethynyl)quinazolin-3-yl]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1-methyl-2,4-dioxo-6-(2-phenylethynyl)quinazolin-3-yl]methyl]benzoic acid?
The IUPAC name of 4-[[1-methyl-2,4-dioxo-6-(2-phenylethynyl)quinazolin-3-yl]methyl]benzoic acid (CID 10223270) is 4-[[1-methyl-2,4-dioxo-6-(2-phenylethynyl)quinazolin-3-yl]methyl]benzoic acid.
What is the SMILES notation for 4-[[1-methyl-2,4-dioxo-6-(2-phenylethynyl)quinazolin-3-yl]methyl]benzoic acid?
The canonical SMILES for 4-[[1-methyl-2,4-dioxo-6-(2-phenylethynyl)quinazolin-3-yl]methyl]benzoic acid is Cn1c(=O)n(Cc2ccc(C(=O)O)cc2)c(=O)c2cc(C#Cc3ccccc3)ccc21.
What is the InChIKey of 4-[[1-methyl-2,4-dioxo-6-(2-phenylethynyl)quinazolin-3-yl]methyl]benzoic acid?
The InChIKey is QQKVWHSHKQNMLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18N2O4/c1-26-22-14-11-18(8-7-17-5-3-2-4-6-17)15-21(22)23(28)27(25(26)31)16-19-9-12-20(13-10-19)24(29)30/h2-6,9-15H,16H2,1H3,(H,29,30).
What are the key properties of 4-[[1-methyl-2,4-dioxo-6-(2-phenylethynyl)quinazolin-3-yl]methyl]benzoic acid?
4-[[1-methyl-2,4-dioxo-6-(2-phenylethynyl)quinazolin-3-yl]methyl]benzoic acid has a molecular weight of 410.43 g/mol, XLogP of 2.85, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-methyl-2,4-dioxo-6-(2-phenylethynyl)quinazolin-3-yl]methyl]benzoic acid is sourced from PubChem (CID 10223270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).