C24H36O3 — CID 102233161
[(3S,5S,9R,10S,13R,14R,17R)-10,13-dimethyl-17-[(2S)-1-oxopropan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 102233161) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is [(3S,5S,9R,10S,13R,14R,17R)-10,13-dimethyl-17-[(2S)-1-oxopropan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5S,9R,10S,13R,14R,17R)-10,13-dimethyl-17-[(2S)-1-oxopropan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 102233161 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | [(3S,5S,9R,10S,13R,14R,17R)-10,13-dimethyl-17-[(2S)-1-oxopropan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)[C@@H](CC=C3[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)C=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C24H36O3/c1-15(14-25)20-7-8-21-19-6-5-17-13-18(27-16(2)26)9-11-23(17,3)22(19)10-12-24(20,21)4/h6,14-15,17-18,20-22H,5,7-13H2,1-4H3/t15-,17+,18+,20-,21+,22+,23+,24-/m1/s1 |
| InChIKey | PSHFPHZGNDYMPD-SZCYIGQKSA-N |
| XLogP | 5.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|