About 3'-benzoyl-1-benzylspiro[indole-3,2'-oxirane]-2-one
3'-benzoyl-1-benzylspiro[indole-3,2'-oxirane]-2-one (PubChem CID 102233839) has the molecular formula C23H17NO3
and a molecular weight of 355.39 g/mol. Its IUPAC name is 3'-benzoyl-1-benzylspiro[indole-3,2'-oxirane]-2-one.
Molecular Properties
| Compound Name | 3'-benzoyl-1-benzylspiro[indole-3,2'-oxirane]-2-one |
| PubChem CID | 102233839 |
| Molecular Formula | C23H17NO3 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 3'-benzoyl-1-benzylspiro[indole-3,2'-oxirane]-2-one |
| SMILES | O=C(c1ccccc1)C1OC12C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C23H17NO3/c25-20(17-11-5-2-6-12-17)21-23(27-21)18-13-7-8-14-19(18)24(22(23)26)15-16-9-3-1-4-10-16/h1-14,21H,15H2 |
| InChIKey | XHTSSOOHJSSFPY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 49.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3'-benzoyl-1-benzylspiro[indole-3,2'-oxirane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-benzoyl-1-benzylspiro[indole-3,2'-oxirane]-2-one?
The IUPAC name of 3'-benzoyl-1-benzylspiro[indole-3,2'-oxirane]-2-one (CID 102233839) is 3'-benzoyl-1-benzylspiro[indole-3,2'-oxirane]-2-one.
What is the SMILES notation for 3'-benzoyl-1-benzylspiro[indole-3,2'-oxirane]-2-one?
The canonical SMILES for 3'-benzoyl-1-benzylspiro[indole-3,2'-oxirane]-2-one is O=C(c1ccccc1)C1OC12C(=O)N(Cc1ccccc1)c1ccccc12.
What is the InChIKey of 3'-benzoyl-1-benzylspiro[indole-3,2'-oxirane]-2-one?
The InChIKey is XHTSSOOHJSSFPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17NO3/c25-20(17-11-5-2-6-12-17)21-23(27-21)18-13-7-8-14-19(18)24(22(23)26)15-16-9-3-1-4-10-16/h1-14,21H,15H2.
What are the key properties of 3'-benzoyl-1-benzylspiro[indole-3,2'-oxirane]-2-one?
3'-benzoyl-1-benzylspiro[indole-3,2'-oxirane]-2-one has a molecular weight of 355.39 g/mol, XLogP of 3.71, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-benzoyl-1-benzylspiro[indole-3,2'-oxirane]-2-one is sourced from PubChem (CID 102233839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).