C16H23F3N2O3S2 — CID 10223407
N-butyl-4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-sulfonamide (PubChem CID 10223407) has the molecular formula C16H23F3N2O3S2 and a molecular weight of 412.50 g/mol. Its IUPAC name is N-butyl-4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-sulfonamide.
| Compound Name | N-butyl-4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 10223407 |
| Molecular Formula | C16H23F3N2O3S2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-butyl-4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-sulfonamide |
| SMILES | CCCCNS(=O)(=O)N1CC(S)CC1COCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C16H23F3N2O3S2/c1-2-3-4-20-26(22,23)21-8-13(25)6-12(21)10-24-9-11-5-15(18)16(19)7-14(11)17/h5,7,12-13,20,25H,2-4,6,8-10H2,1H3 |
| InChIKey | NETUSJJXPNREKD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|