C24H24BN3O3 — CID 10223450
[5-(2-carbamimidoyl-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinolin-6-yl)-2-methoxyphenyl]boronic acid (PubChem CID 10223450) has the molecular formula C24H24BN3O3 and a molecular weight of 413.29 g/mol. Its IUPAC name is [5-(2-carbamimidoyl-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinolin-6-yl)-2-methoxyphenyl]boronic acid.
| Compound Name | [5-(2-carbamimidoyl-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinolin-6-yl)-2-methoxyphenyl]boronic acid |
|---|---|
| PubChem CID | 10223450 |
| Molecular Formula | C24H24BN3O3 |
| Molecular Weight | 413.29 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | [5-(2-carbamimidoyl-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinolin-6-yl)-2-methoxyphenyl]boronic acid |
| SMILES | [H]/N=C(\N)c1ccc2c(c1)C1c3ccccc3CC1C(c1ccc(OC)c(B(O)O)c1)N2 |
| InChI | InChI=1S/C24H24BN3O3/c1-31-21-9-7-14(12-19(21)25(29)30)23-18-10-13-4-2-3-5-16(13)22(18)17-11-15(24(26)27)6-8-20(17)28-23/h2-9,11-12,18,22-23,28-30H,10H2,1H3,(H3,26,27) |
| InChIKey | QAGOZGUNARWBKY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 111.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|