C27H35NO2 — CID 102234824
tert-butyl (1S,7S)-7-[benzyl-[(1S)-1-phenylethyl]amino]cyclohept-3-ene-1-carboxylate (PubChem CID 102234824) has the molecular formula C27H35NO2 and a molecular weight of 405.58 g/mol. Its IUPAC name is tert-butyl (1S,7S)-7-[benzyl-[(1S)-1-phenylethyl]amino]cyclohept-3-ene-1-carboxylate.
| Compound Name | tert-butyl (1S,7S)-7-[benzyl-[(1S)-1-phenylethyl]amino]cyclohept-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 102234824 |
| Molecular Formula | C27H35NO2 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | tert-butyl (1S,7S)-7-[benzyl-[(1S)-1-phenylethyl]amino]cyclohept-3-ene-1-carboxylate |
| SMILES | C[C@@H](c1ccccc1)N(Cc1ccccc1)[C@H]1CCC=CC[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H35NO2/c1-21(23-16-10-6-11-17-23)28(20-22-14-8-5-9-15-22)25-19-13-7-12-18-24(25)26(29)30-27(2,3)4/h5-12,14-17,21,24-25H,13,18-20H2,1-4H3/t21-,24-,25-/m0/s1 |
| InChIKey | FENQWKOHLMSTLK-TUSQITKMSA-N |
| XLogP | 6.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|