About (2R)-1,1,1-trichlorododec-11-en-2-ol
(2R)-1,1,1-trichlorododec-11-en-2-ol (PubChem CID 102235187) has the molecular formula C12H21Cl3O
and a molecular weight of 287.66 g/mol. Its IUPAC name is (2R)-1,1,1-trichlorododec-11-en-2-ol.
Molecular Properties
| Compound Name | (2R)-1,1,1-trichlorododec-11-en-2-ol |
| PubChem CID | 102235187 |
| Molecular Formula | C12H21Cl3O |
| Molecular Weight | 287.66 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | (2R)-1,1,1-trichlorododec-11-en-2-ol |
| SMILES | C=CCCCCCCCC[C@@H](O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H21Cl3O/c1-2-3-4-5-6-7-8-9-10-11(16)12(13,14)15/h2,11,16H,1,3-10H2/t11-/m1/s1 |
| InChIKey | FEKZQFCXJXCIHQ-LLVKDONJSA-N |
| XLogP | 5.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.66 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1,1,1-trichlorododec-11-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,1,1-trichlorododec-11-en-2-ol?
The IUPAC name of (2R)-1,1,1-trichlorododec-11-en-2-ol (CID 102235187) is (2R)-1,1,1-trichlorododec-11-en-2-ol.
What is the SMILES notation for (2R)-1,1,1-trichlorododec-11-en-2-ol?
The canonical SMILES for (2R)-1,1,1-trichlorododec-11-en-2-ol is C=CCCCCCCCC[C@@H](O)C(Cl)(Cl)Cl.
What is the InChIKey of (2R)-1,1,1-trichlorododec-11-en-2-ol?
The InChIKey is FEKZQFCXJXCIHQ-LLVKDONJSA-N. The full InChI is InChI=1S/C12H21Cl3O/c1-2-3-4-5-6-7-8-9-10-11(16)12(13,14)15/h2,11,16H,1,3-10H2/t11-/m1/s1.
What are the key properties of (2R)-1,1,1-trichlorododec-11-en-2-ol?
(2R)-1,1,1-trichlorododec-11-en-2-ol has a molecular weight of 287.66 g/mol, XLogP of 5.02, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,1,1-trichlorododec-11-en-2-ol is sourced from PubChem (CID 102235187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).