C27H30N2O2 — CID 10223541
1-[(2R,4S)-4-(3,5-dimethyl-4-phenylmethoxyanilino)-2-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone (PubChem CID 10223541) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 1-[(2R,4S)-4-(3,5-dimethyl-4-phenylmethoxyanilino)-2-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone.
| Compound Name | 1-[(2R,4S)-4-(3,5-dimethyl-4-phenylmethoxyanilino)-2-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone |
|---|---|
| PubChem CID | 10223541 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 1-[(2R,4S)-4-(3,5-dimethyl-4-phenylmethoxyanilino)-2-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone |
| SMILES | CC(=O)N1c2ccccc2[C@@H](Nc2cc(C)c(OCc3ccccc3)c(C)c2)C[C@H]1C |
| InChI | InChI=1S/C27H30N2O2/c1-18-14-23(15-19(2)27(18)31-17-22-10-6-5-7-11-22)28-25-16-20(3)29(21(4)30)26-13-9-8-12-24(25)26/h5-15,20,25,28H,16-17H2,1-4H3/t20-,25+/m1/s1 |
| InChIKey | GRNAOCKNFOKPOH-NLFFAJNJSA-N |
| XLogP | 6.18 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|