3-[3,5-dibromo-4-(pyridin-4-ylmethoxy)phenyl]propanoic acid

C15H13Br2NO3 — CID 10223558

IUPAC3-[3,5-dibromo-4-(pyridin-4-ylmethoxy)phenyl]propanoic acid
SMILESO=C(O)CCc1cc(Br)c(OCc2ccncc2)c(Br)c1
InChIInChI=1S/C15H13Br2NO3/c16-12-7-11(1-2-14(19)20)8-13(17)15(12)21-9-10-3-5-18-6-4-10/h3-8H,1-2,9H2,(H,19,20)
InChIKeyZUTZXSDBCRMUFH-UHFFFAOYSA-N
MW415.08 g/mol
LogP4.20
Rot. Bonds6

About 3-[3,5-dibromo-4-(pyridin-4-ylmethoxy)phenyl]propanoic acid

3-[3,5-dibromo-4-(pyridin-4-ylmethoxy)phenyl]propanoic acid (PubChem CID 10223558) has the molecular formula C15H13Br2NO3 and a molecular weight of 415.08 g/mol. Its IUPAC name is 3-[3,5-dibromo-4-(pyridin-4-ylmethoxy)phenyl]propanoic acid.

Molecular Properties

Compound Name3-[3,5-dibromo-4-(pyridin-4-ylmethoxy)phenyl]propanoic acid
PubChem CID10223558
Molecular FormulaC15H13Br2NO3
Molecular Weight415.08 g/mol
Exact Mass412.93
IUPAC Name3-[3,5-dibromo-4-(pyridin-4-ylmethoxy)phenyl]propanoic acid
SMILESO=C(O)CCc1cc(Br)c(OCc2ccncc2)c(Br)c1
InChIInChI=1S/C15H13Br2NO3/c16-12-7-11(1-2-14(19)20)8-13(17)15(12)21-9-10-3-5-18-6-4-10/h3-8H,1-2,9H2,(H,19,20)
InChIKeyZUTZXSDBCRMUFH-UHFFFAOYSA-N
XLogP4.20
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500415.08
LogP ≤ 54.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[3,5-dibromo-4-(pyridin-4-ylmethoxy)phenyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[3,5-dibromo-4-(pyridin-4-ylmethoxy)phenyl]propanoic acid?
The IUPAC name of 3-[3,5-dibromo-4-(pyridin-4-ylmethoxy)phenyl]propanoic acid (CID 10223558) is 3-[3,5-dibromo-4-(pyridin-4-ylmethoxy)phenyl]propanoic acid.
What is the SMILES notation for 3-[3,5-dibromo-4-(pyridin-4-ylmethoxy)phenyl]propanoic acid?
The canonical SMILES for 3-[3,5-dibromo-4-(pyridin-4-ylmethoxy)phenyl]propanoic acid is O=C(O)CCc1cc(Br)c(OCc2ccncc2)c(Br)c1.
What is the InChIKey of 3-[3,5-dibromo-4-(pyridin-4-ylmethoxy)phenyl]propanoic acid?
The InChIKey is ZUTZXSDBCRMUFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Br2NO3/c16-12-7-11(1-2-14(19)20)8-13(17)15(12)21-9-10-3-5-18-6-4-10/h3-8H,1-2,9H2,(H,19,20).
What are the key properties of 3-[3,5-dibromo-4-(pyridin-4-ylmethoxy)phenyl]propanoic acid?
3-[3,5-dibromo-4-(pyridin-4-ylmethoxy)phenyl]propanoic acid has a molecular weight of 415.08 g/mol, XLogP of 4.20, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-dibromo-4-(pyridin-4-ylmethoxy)phenyl]propanoic acid is sourced from PubChem (CID 10223558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).