About 2-[(E)-4-(4-methoxy-2,3-dimethylphenyl)but-2-en-2-yl]-1,3-dithiane
2-[(E)-4-(4-methoxy-2,3-dimethylphenyl)but-2-en-2-yl]-1,3-dithiane (PubChem CID 102236605) has the molecular formula C17H24OS2
and a molecular weight of 308.51 g/mol. Its IUPAC name is 2-[(E)-4-(4-methoxy-2,3-dimethylphenyl)but-2-en-2-yl]-1,3-dithiane.
Molecular Properties
| Compound Name | 2-[(E)-4-(4-methoxy-2,3-dimethylphenyl)but-2-en-2-yl]-1,3-dithiane |
| PubChem CID | 102236605 |
| Molecular Formula | C17H24OS2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-[(E)-4-(4-methoxy-2,3-dimethylphenyl)but-2-en-2-yl]-1,3-dithiane |
| SMILES | COc1ccc(C/C=C(\C)C2SCCCS2)c(C)c1C |
| InChI | InChI=1S/C17H24OS2/c1-12(17-19-10-5-11-20-17)6-7-15-8-9-16(18-4)14(3)13(15)2/h6,8-9,17H,5,7,10-11H2,1-4H3/b12-6+ |
| InChIKey | WRUWFZNHMDDETJ-WUXMJOGZSA-N |
| XLogP | 5.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-4-(4-methoxy-2,3-dimethylphenyl)but-2-en-2-yl]-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-4-(4-methoxy-2,3-dimethylphenyl)but-2-en-2-yl]-1,3-dithiane?
The IUPAC name of 2-[(E)-4-(4-methoxy-2,3-dimethylphenyl)but-2-en-2-yl]-1,3-dithiane (CID 102236605) is 2-[(E)-4-(4-methoxy-2,3-dimethylphenyl)but-2-en-2-yl]-1,3-dithiane.
What is the SMILES notation for 2-[(E)-4-(4-methoxy-2,3-dimethylphenyl)but-2-en-2-yl]-1,3-dithiane?
The canonical SMILES for 2-[(E)-4-(4-methoxy-2,3-dimethylphenyl)but-2-en-2-yl]-1,3-dithiane is COc1ccc(C/C=C(\C)C2SCCCS2)c(C)c1C.
What is the InChIKey of 2-[(E)-4-(4-methoxy-2,3-dimethylphenyl)but-2-en-2-yl]-1,3-dithiane?
The InChIKey is WRUWFZNHMDDETJ-WUXMJOGZSA-N. The full InChI is InChI=1S/C17H24OS2/c1-12(17-19-10-5-11-20-17)6-7-15-8-9-16(18-4)14(3)13(15)2/h6,8-9,17H,5,7,10-11H2,1-4H3/b12-6+.
What are the key properties of 2-[(E)-4-(4-methoxy-2,3-dimethylphenyl)but-2-en-2-yl]-1,3-dithiane?
2-[(E)-4-(4-methoxy-2,3-dimethylphenyl)but-2-en-2-yl]-1,3-dithiane has a molecular weight of 308.51 g/mol, XLogP of 5.00, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-4-(4-methoxy-2,3-dimethylphenyl)but-2-en-2-yl]-1,3-dithiane is sourced from PubChem (CID 102236605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).