C26H18Br2O5 — CID 102236749
6,22-dibromo-5,23-dimethoxy-14-oxahexacyclo[15.8.0.02,11.03,8.012,16.020,25]pentacosa-1(17),2(11),3,5,7,12(16),20,22,24-nonaene-13,15-dione (PubChem CID 102236749) has the molecular formula C26H18Br2O5 and a molecular weight of 570.23 g/mol. Its IUPAC name is 6,22-dibromo-5,23-dimethoxy-14-oxahexacyclo[15.8.0.02,11.03,8.012,16.020,25]pentacosa-1(17),2(11),3,5,7,12(16),20,22,24-nonaene-13,15-dione.
| Compound Name | 6,22-dibromo-5,23-dimethoxy-14-oxahexacyclo[15.8.0.02,11.03,8.012,16.020,25]pentacosa-1(17),2(11),3,5,7,12(16),20,22,24-nonaene-13,15-dione |
|---|---|
| PubChem CID | 102236749 |
| Molecular Formula | C26H18Br2O5 |
| Molecular Weight | 570.23 g/mol |
| Exact Mass | 567.95 |
| IUPAC Name | 6,22-dibromo-5,23-dimethoxy-14-oxahexacyclo[15.8.0.02,11.03,8.012,16.020,25]pentacosa-1(17),2(11),3,5,7,12(16),20,22,24-nonaene-13,15-dione |
| SMILES | COc1cc2c(cc1Br)CCc1c3c(c4c(c1-2)-c1cc(OC)c(Br)cc1CC4)C(=O)OC3=O |
| InChI | InChI=1S/C26H18Br2O5/c1-31-19-9-15-11(7-17(19)27)3-5-13-21(15)22-14(24-23(13)25(29)33-26(24)30)6-4-12-8-18(28)20(32-2)10-16(12)22/h7-10H,3-6H2,1-2H3 |
| InChIKey | DOQICQVCZCRWAJ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.23 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|