C16H24O5 — CID 102236896
(1R,6R,9S,10S)-6,10-dihydroxy-15-methyl-8,16-dioxatricyclo[7.7.1.02,7]heptadec-2(7)-en-3-one (PubChem CID 102236896) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is (1R,6R,9S,10S)-6,10-dihydroxy-15-methyl-8,16-dioxatricyclo[7.7.1.02,7]heptadec-2(7)-en-3-one.
| Compound Name | (1R,6R,9S,10S)-6,10-dihydroxy-15-methyl-8,16-dioxatricyclo[7.7.1.02,7]heptadec-2(7)-en-3-one |
|---|---|
| PubChem CID | 102236896 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (1R,6R,9S,10S)-6,10-dihydroxy-15-methyl-8,16-dioxatricyclo[7.7.1.02,7]heptadec-2(7)-en-3-one |
| SMILES | CC1CCCC[C@H](O)[C@@H]2C[C@@H](O1)C1=C(O2)[C@H](O)CCC1=O |
| InChI | InChI=1S/C16H24O5/c1-9-4-2-3-5-10(17)13-8-14(20-9)15-11(18)6-7-12(19)16(15)21-13/h9-10,12-14,17,19H,2-8H2,1H3/t9?,10-,12+,13-,14+/m0/s1 |
| InChIKey | PIEPQYGMNJGUKR-NCDGTBIOSA-N |
| XLogP | 1.46 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |