C32H58Si6 — CID 102237024
[2,3-bis(trimethylsilyl)-4-[3-[2,3,4-tris(trimethylsilyl)-1-tricyclo[1.1.0.02,4]butanyl]phenyl]-1-tricyclo[1.1.0.02,4]butanyl]-trimethylsilane (PubChem CID 102237024) has the molecular formula C32H58Si6 and a molecular weight of 611.33 g/mol. Its IUPAC name is [2,3-bis(trimethylsilyl)-4-[3-[2,3,4-tris(trimethylsilyl)-1-tricyclo[1.1.0.02,4]butanyl]phenyl]-1-tricyclo[1.1.0.02,4]butanyl]-trimethylsilane.
| Compound Name | [2,3-bis(trimethylsilyl)-4-[3-[2,3,4-tris(trimethylsilyl)-1-tricyclo[1.1.0.02,4]butanyl]phenyl]-1-tricyclo[1.1.0.02,4]butanyl]-trimethylsilane |
|---|---|
| PubChem CID | 102237024 |
| Molecular Formula | C32H58Si6 |
| Molecular Weight | 611.33 g/mol |
| Exact Mass | 610.32 |
| IUPAC Name | [2,3-bis(trimethylsilyl)-4-[3-[2,3,4-tris(trimethylsilyl)-1-tricyclo[1.1.0.02,4]butanyl]phenyl]-1-tricyclo[1.1.0.02,4]butanyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C12C3(c4cccc(C56C7([Si](C)(C)C)C5([Si](C)(C)C)C67[Si](C)(C)C)c4)C1([Si](C)(C)C)C32[Si](C)(C)C |
| InChI | InChI=1S/C32H58Si6/c1-33(2,3)27-25(28(27,34(4,5)6)29(25,27)35(7,8)9)23-20-19-21-24(22-23)26-30(36(10,11)12)31(26,37(13,14)15)32(26,30)38(16,17)18/h19-22H,1-18H3 |
| InChIKey | QTMNAUPOKSMXGN-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.33 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|