C41H64O9Si2 — CID 102237560
[(1S,2S,3R,4S,8S,9S,11R,14S)-4-acetyloxy-1,14-dihydroxy-9,13,16,16-tetramethyl-10-oxo-8,11-bis(triethylsilyloxy)-2-tetracyclo[10.3.1.03,9.04,6]hexadec-12-enyl] benzoate (PubChem CID 102237560) has the molecular formula C41H64O9Si2 and a molecular weight of 757.13 g/mol. Its IUPAC name is [(1S,2S,3R,4S,8S,9S,11R,14S)-4-acetyloxy-1,14-dihydroxy-9,13,16,16-tetramethyl-10-oxo-8,11-bis(triethylsilyloxy)-2-tetracyclo[10.3.1.03,9.04,6]hexadec-12-enyl] benzoate.
| Compound Name | [(1S,2S,3R,4S,8S,9S,11R,14S)-4-acetyloxy-1,14-dihydroxy-9,13,16,16-tetramethyl-10-oxo-8,11-bis(triethylsilyloxy)-2-tetracyclo[10.3.1.03,9.04,6]hexadec-12-enyl] benzoate |
|---|---|
| PubChem CID | 102237560 |
| Molecular Formula | C41H64O9Si2 |
| Molecular Weight | 757.13 g/mol |
| Exact Mass | 756.41 |
| IUPAC Name | [(1S,2S,3R,4S,8S,9S,11R,14S)-4-acetyloxy-1,14-dihydroxy-9,13,16,16-tetramethyl-10-oxo-8,11-bis(triethylsilyloxy)-2-tetracyclo[10.3.1.03,9.04,6]hexadec-12-enyl] benzoate |
| SMILES | CC[Si](CC)(CC)O[C@H]1C(=O)[C@]2(C)[C@@H](O[Si](CC)(CC)CC)CC3C[C@@]3(OC(C)=O)[C@H]2[C@H](OC(=O)c2ccccc2)[C@]2(O)C[C@H](O)C(C)=C1C2(C)C |
| InChI | InChI=1S/C41H64O9Si2/c1-12-51(13-2,14-3)49-31-23-29-24-40(29,48-27(8)42)34-36(47-37(45)28-21-19-18-20-22-28)41(46)25-30(43)26(7)32(38(41,9)10)33(35(44)39(31,34)11)50-52(15-4,16-5)17-6/h18-22,29-31,33-34,36,43,46H,12-17,23-25H2,1-11H3/t29?,30-,31-,33+,34-,36-,39+,40-,41+/m0/s1 |
| InChIKey | OTZQFBONKHGTKE-DXPYACCJSA-N |
| XLogP | 7.76 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.13 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|