C22H21F4N3O — CID 10223807
(E,2R,3S)-6-[4-(difluoromethyl)phenyl]-2-(2,4-difluorophenyl)-3-methyl-1-(1,2,4-triazol-1-yl)hex-5-en-2-ol (PubChem CID 10223807) has the molecular formula C22H21F4N3O and a molecular weight of 419.42 g/mol. Its IUPAC name is (E,2R,3S)-6-[4-(difluoromethyl)phenyl]-2-(2,4-difluorophenyl)-3-methyl-1-(1,2,4-triazol-1-yl)hex-5-en-2-ol.
| Compound Name | (E,2R,3S)-6-[4-(difluoromethyl)phenyl]-2-(2,4-difluorophenyl)-3-methyl-1-(1,2,4-triazol-1-yl)hex-5-en-2-ol |
|---|---|
| PubChem CID | 10223807 |
| Molecular Formula | C22H21F4N3O |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | (E,2R,3S)-6-[4-(difluoromethyl)phenyl]-2-(2,4-difluorophenyl)-3-methyl-1-(1,2,4-triazol-1-yl)hex-5-en-2-ol |
| SMILES | C[C@@H](C/C=C/c1ccc(C(F)F)cc1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C22H21F4N3O/c1-15(3-2-4-16-5-7-17(8-6-16)21(25)26)22(30,12-29-14-27-13-28-29)19-10-9-18(23)11-20(19)24/h2,4-11,13-15,21,30H,3,12H2,1H3/b4-2+/t15-,22+/m0/s1 |
| InChIKey | ZCGVQUPBPGCFSX-CLGHRCLESA-N |
| XLogP | 5.12 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |