About 5,10-dihydrophenazine-2,7-diamine
5,10-dihydrophenazine-2,7-diamine (PubChem CID 102238341) has the molecular formula C12H12N4
and a molecular weight of 212.26 g/mol. Its IUPAC name is 5,10-dihydrophenazine-2,7-diamine.
Molecular Properties
| Compound Name | 5,10-dihydrophenazine-2,7-diamine |
| PubChem CID | 102238341 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 5,10-dihydrophenazine-2,7-diamine |
| SMILES | Nc1ccc2c(c1)Nc1ccc(N)cc1N2 |
| InChI | InChI=1S/C12H12N4/c13-7-1-3-9-11(5-7)16-10-4-2-8(14)6-12(10)15-9/h1-6,15-16H,13-14H2 |
| InChIKey | TXJWLKOBWOFUDF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5,10-dihydrophenazine-2,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,10-dihydrophenazine-2,7-diamine?
The IUPAC name of 5,10-dihydrophenazine-2,7-diamine (CID 102238341) is 5,10-dihydrophenazine-2,7-diamine.
What is the SMILES notation for 5,10-dihydrophenazine-2,7-diamine?
The canonical SMILES for 5,10-dihydrophenazine-2,7-diamine is Nc1ccc2c(c1)Nc1ccc(N)cc1N2.
What is the InChIKey of 5,10-dihydrophenazine-2,7-diamine?
The InChIKey is TXJWLKOBWOFUDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4/c13-7-1-3-9-11(5-7)16-10-4-2-8(14)6-12(10)15-9/h1-6,15-16H,13-14H2.
What are the key properties of 5,10-dihydrophenazine-2,7-diamine?
5,10-dihydrophenazine-2,7-diamine has a molecular weight of 212.26 g/mol, XLogP of 2.65, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,10-dihydrophenazine-2,7-diamine is sourced from PubChem (CID 102238341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).