C15H27F3O2 — CID 102238848
(3E)-1,1,1-trifluoro-3-pentylidenedecane-2,6-diol (PubChem CID 102238848) has the molecular formula C15H27F3O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (3E)-1,1,1-trifluoro-3-pentylidenedecane-2,6-diol.
| Compound Name | (3E)-1,1,1-trifluoro-3-pentylidenedecane-2,6-diol |
|---|---|
| PubChem CID | 102238848 |
| Molecular Formula | C15H27F3O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (3E)-1,1,1-trifluoro-3-pentylidenedecane-2,6-diol |
| SMILES | CCCC/C=C(\CCC(O)CCCC)C(O)C(F)(F)F |
| InChI | InChI=1S/C15H27F3O2/c1-3-5-7-8-12(14(20)15(16,17)18)10-11-13(19)9-6-4-2/h8,13-14,19-20H,3-7,9-11H2,1-2H3/b12-8+ |
| InChIKey | XHKMSUVLWVRDQQ-XYOKQWHBSA-N |
| XLogP | 4.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|