C20H30N2O12 — CID 102239227
[(2S,3R,4R,5R)-2-[acetamido(acetyl)amino]-3,4,5,6-tetraacetyloxyhexyl] acetate (PubChem CID 102239227) has the molecular formula C20H30N2O12 and a molecular weight of 490.46 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-2-[acetamido(acetyl)amino]-3,4,5,6-tetraacetyloxyhexyl] acetate.
| Compound Name | [(2S,3R,4R,5R)-2-[acetamido(acetyl)amino]-3,4,5,6-tetraacetyloxyhexyl] acetate |
|---|---|
| PubChem CID | 102239227 |
| Molecular Formula | C20H30N2O12 |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | [(2S,3R,4R,5R)-2-[acetamido(acetyl)amino]-3,4,5,6-tetraacetyloxyhexyl] acetate |
| SMILES | CC(=O)NN(C(C)=O)[C@@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C20H30N2O12/c1-10(23)21-22(11(2)24)17(8-30-12(3)25)19(33-15(6)28)20(34-16(7)29)18(32-14(5)27)9-31-13(4)26/h17-20H,8-9H2,1-7H3,(H,21,23)/t17-,18+,19+,20-/m0/s1 |
| InChIKey | JVKIUULNTKAXLY-NMLBUPMWSA-N |
| XLogP | -0.82 |
| TPSA | 180.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|