Filifolide B

C10H14O2 — CID 102239722

IUPAC(1R,5S)-4,8,8-trimethyl-6-oxabicyclo[3.2.1]oct-3-en-7-one
SMILESCC1=CC[C@H]2C(=O)O[C@@H]1C2(C)C
InChIInChI=1S/C10H14O2/c1-6-4-5-7-9(11)12-8(6)10(7,2)3/h4,7-8H,5H2,1-3H3/t7-,8-/m0/s1
InChIKeyCGEVOYRUHMDHSE-YUMQZZPRSA-N
MW166.22 g/mol
LogP1.70
Rot. Bonds

About Filifolide B

Filifolide B (PubChem CID 102239722) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (1R,5S)-4,8,8-trimethyl-6-oxabicyclo[3.2.1]oct-3-en-7-one.

Molecular Properties

Compound NameFilifolide B
PubChem CID102239722
Molecular FormulaC10H14O2
Molecular Weight166.22 g/mol
Exact Mass166.10
IUPAC Name(1R,5S)-4,8,8-trimethyl-6-oxabicyclo[3.2.1]oct-3-en-7-one
SMILESCC1=CC[C@H]2C(=O)O[C@@H]1C2(C)C
InChIInChI=1S/C10H14O2/c1-6-4-5-7-9(11)12-8(6)10(7,2)3/h4,7-8H,5H2,1-3H3/t7-,8-/m0/s1
InChIKeyCGEVOYRUHMDHSE-YUMQZZPRSA-N
XLogP1.70
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms12
Complexity263

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.22
LogP ≤ 51.70
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze Filifolide B with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of Filifolide B?
The IUPAC name of Filifolide B (CID 102239722) is (1R,5S)-4,8,8-trimethyl-6-oxabicyclo[3.2.1]oct-3-en-7-one.
What is the SMILES notation for Filifolide B?
The canonical SMILES for Filifolide B is CC1=CC[C@H]2C(=O)O[C@@H]1C2(C)C.
What is the InChIKey of Filifolide B?
The InChIKey is CGEVOYRUHMDHSE-YUMQZZPRSA-N. The full InChI is InChI=1S/C10H14O2/c1-6-4-5-7-9(11)12-8(6)10(7,2)3/h4,7-8H,5H2,1-3H3/t7-,8-/m0/s1.
What are the key properties of Filifolide B?
Filifolide B has a molecular weight of 166.22 g/mol, XLogP of 1.70, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Filifolide B is sourced from PubChem (CID 102239722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).