C30H10Br4O2 — CID 102240172
5,6,7,14-tetrabromopyranthrene-8,16-dione (PubChem CID 102240172) has the molecular formula C30H10Br4O2 and a molecular weight of 722.02 g/mol. Its IUPAC name is 5,6,7,14-tetrabromopyranthrene-8,16-dione.
| Compound Name | 5,6,7,14-tetrabromopyranthrene-8,16-dione |
|---|---|
| PubChem CID | 102240172 |
| Molecular Formula | C30H10Br4O2 |
| Molecular Weight | 722.02 g/mol |
| Exact Mass | 717.74 |
| IUPAC Name | 5,6,7,14-tetrabromopyranthrene-8,16-dione |
| SMILES | O=c1c2ccccc2c2c(Br)c3c(Br)c(Br)c4c(=O)c5ccccc5c5cc6c(Br)cc1c2c6c3c45 |
| InChI | InChI=1S/C30H10Br4O2/c31-18-10-17-21-20-16(18)9-15-11-5-1-3-7-13(11)30(36)25-19(15)23(20)24(27(33)28(25)34)26(32)22(21)12-6-2-4-8-14(12)29(17)35/h1-10H |
| InChIKey | VPWHFSVZVBRVQP-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.02 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|