About 2-(4-ethoxyanilino)-N,N-diethyl-1-(3-methylbutyl)benzimidazole-5-carboxamide
2-(4-ethoxyanilino)-N,N-diethyl-1-(3-methylbutyl)benzimidazole-5-carboxamide (PubChem CID 10224082) has the molecular formula C25H34N4O2
and a molecular weight of 422.57 g/mol. Its IUPAC name is 2-(4-ethoxyanilino)-N,N-diethyl-1-(3-methylbutyl)benzimidazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-(4-ethoxyanilino)-N,N-diethyl-1-(3-methylbutyl)benzimidazole-5-carboxamide |
| PubChem CID | 10224082 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 2-(4-ethoxyanilino)-N,N-diethyl-1-(3-methylbutyl)benzimidazole-5-carboxamide |
| SMILES | CCOc1ccc(Nc2nc3cc(C(=O)N(CC)CC)ccc3n2CCC(C)C)cc1 |
| InChI | InChI=1S/C25H34N4O2/c1-6-28(7-2)24(30)19-9-14-23-22(17-19)27-25(29(23)16-15-18(4)5)26-20-10-12-21(13-11-20)31-8-3/h9-14,17-18H,6-8,15-16H2,1-5H3,(H,26,27) |
| InChIKey | OIFJPDXHVAIHHP-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-ethoxyanilino)-N,N-diethyl-1-(3-methylbutyl)benzimidazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethoxyanilino)-N,N-diethyl-1-(3-methylbutyl)benzimidazole-5-carboxamide?
The IUPAC name of 2-(4-ethoxyanilino)-N,N-diethyl-1-(3-methylbutyl)benzimidazole-5-carboxamide (CID 10224082) is 2-(4-ethoxyanilino)-N,N-diethyl-1-(3-methylbutyl)benzimidazole-5-carboxamide.
What is the SMILES notation for 2-(4-ethoxyanilino)-N,N-diethyl-1-(3-methylbutyl)benzimidazole-5-carboxamide?
The canonical SMILES for 2-(4-ethoxyanilino)-N,N-diethyl-1-(3-methylbutyl)benzimidazole-5-carboxamide is CCOc1ccc(Nc2nc3cc(C(=O)N(CC)CC)ccc3n2CCC(C)C)cc1.
What is the InChIKey of 2-(4-ethoxyanilino)-N,N-diethyl-1-(3-methylbutyl)benzimidazole-5-carboxamide?
The InChIKey is OIFJPDXHVAIHHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H34N4O2/c1-6-28(7-2)24(30)19-9-14-23-22(17-19)27-25(29(23)16-15-18(4)5)26-20-10-12-21(13-11-20)31-8-3/h9-14,17-18H,6-8,15-16H2,1-5H3,(H,26,27).
What are the key properties of 2-(4-ethoxyanilino)-N,N-diethyl-1-(3-methylbutyl)benzimidazole-5-carboxamide?
2-(4-ethoxyanilino)-N,N-diethyl-1-(3-methylbutyl)benzimidazole-5-carboxamide has a molecular weight of 422.57 g/mol, XLogP of 5.71, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethoxyanilino)-N,N-diethyl-1-(3-methylbutyl)benzimidazole-5-carboxamide is sourced from PubChem (CID 10224082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).