C25H27NO3 — CID 102241239
(10S)-10-benzyl-15,16-dimethoxy-11-methyl-8-oxa-11-azatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaene (PubChem CID 102241239) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is (10S)-10-benzyl-15,16-dimethoxy-11-methyl-8-oxa-11-azatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaene.
| Compound Name | (10S)-10-benzyl-15,16-dimethoxy-11-methyl-8-oxa-11-azatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaene |
|---|---|
| PubChem CID | 102241239 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (10S)-10-benzyl-15,16-dimethoxy-11-methyl-8-oxa-11-azatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,13,15-hexaene |
| SMILES | COc1cc2c(cc1OC)-c1ccccc1OC[C@H](Cc1ccccc1)N(C)C2 |
| InChI | InChI=1S/C25H27NO3/c1-26-16-19-14-24(27-2)25(28-3)15-22(19)21-11-7-8-12-23(21)29-17-20(26)13-18-9-5-4-6-10-18/h4-12,14-15,20H,13,16-17H2,1-3H3/t20-/m0/s1 |
| InChIKey | MHHLQFJQPOXKCW-FQEVSTJZSA-N |
| XLogP | 4.81 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |