C20H23F2N3O3S — CID 10224124
3-[2-fluoro-4-(3-fluorophenyl)phenyl]-1-methyl-1-(1-methylsulfonylpiperidin-4-yl)urea (PubChem CID 10224124) has the molecular formula C20H23F2N3O3S and a molecular weight of 423.49 g/mol. Its IUPAC name is 3-[2-fluoro-4-(3-fluorophenyl)phenyl]-1-methyl-1-(1-methylsulfonylpiperidin-4-yl)urea.
| Compound Name | 3-[2-fluoro-4-(3-fluorophenyl)phenyl]-1-methyl-1-(1-methylsulfonylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 10224124 |
| Molecular Formula | C20H23F2N3O3S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 3-[2-fluoro-4-(3-fluorophenyl)phenyl]-1-methyl-1-(1-methylsulfonylpiperidin-4-yl)urea |
| SMILES | CN(C(=O)Nc1ccc(-c2cccc(F)c2)cc1F)C1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C20H23F2N3O3S/c1-24(17-8-10-25(11-9-17)29(2,27)28)20(26)23-19-7-6-15(13-18(19)22)14-4-3-5-16(21)12-14/h3-7,12-13,17H,8-11H2,1-2H3,(H,23,26) |
| InChIKey | VVGLSQXAVKWRHD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |