C21H25N3O4 — CID 102241842
[4-(diazenylmethyl)phenyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate (PubChem CID 102241842) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is [4-(diazenylmethyl)phenyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate.
| Compound Name | [4-(diazenylmethyl)phenyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 102241842 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | [4-(diazenylmethyl)phenyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
| SMILES | [H]/N=N/Cc1ccc(OC(=O)[C@H](Cc2ccccc2)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H25N3O4/c1-21(2,3)28-20(26)24-18(13-15-7-5-4-6-8-15)19(25)27-17-11-9-16(10-12-17)14-23-22/h4-12,18,22H,13-14H2,1-3H3,(H,24,26)/b23-22+/t18-/m0/s1 |
| InChIKey | GVCCCJHKPJYMQS-CCWVLBSLSA-N |
| XLogP | 4.26 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|