C25H25ClN2O3 — CID 102242040
N-(2-benzyl-3,4-dihydro-1H-isoquinolin-5-yl)-5-chloro-2,4-dimethoxybenzamide (PubChem CID 102242040) has the molecular formula C25H25ClN2O3 and a molecular weight of 436.94 g/mol. Its IUPAC name is N-(2-benzyl-3,4-dihydro-1H-isoquinolin-5-yl)-5-chloro-2,4-dimethoxybenzamide.
| Compound Name | N-(2-benzyl-3,4-dihydro-1H-isoquinolin-5-yl)-5-chloro-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 102242040 |
| Molecular Formula | C25H25ClN2O3 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-(2-benzyl-3,4-dihydro-1H-isoquinolin-5-yl)-5-chloro-2,4-dimethoxybenzamide |
| SMILES | COc1cc(OC)c(C(=O)Nc2cccc3c2CCN(Cc2ccccc2)C3)cc1Cl |
| InChI | InChI=1S/C25H25ClN2O3/c1-30-23-14-24(31-2)21(26)13-20(23)25(29)27-22-10-6-9-18-16-28(12-11-19(18)22)15-17-7-4-3-5-8-17/h3-10,13-14H,11-12,15-16H2,1-2H3,(H,27,29) |
| InChIKey | OCHMYDGILNJKLE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |