About (4-methoxyphenyl)-(1-methyl-6-phenyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrimidin-8-yl)methanone
(4-methoxyphenyl)-(1-methyl-6-phenyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrimidin-8-yl)methanone (PubChem CID 102242060) has the molecular formula C22H22N2O2
and a molecular weight of 346.43 g/mol. Its IUPAC name is (4-methoxyphenyl)-(1-methyl-6-phenyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrimidin-8-yl)methanone.
Molecular Properties
| Compound Name | (4-methoxyphenyl)-(1-methyl-6-phenyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrimidin-8-yl)methanone |
| PubChem CID | 102242060 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | (4-methoxyphenyl)-(1-methyl-6-phenyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrimidin-8-yl)methanone |
| SMILES | COc1ccc(C(=O)c2cc(-c3ccccc3)n3c2N(C)CCC3)cc1 |
| InChI | InChI=1S/C22H22N2O2/c1-23-13-6-14-24-20(16-7-4-3-5-8-16)15-19(22(23)24)21(25)17-9-11-18(26-2)12-10-17/h3-5,7-12,15H,6,13-14H2,1-2H3 |
| InChIKey | LSPOBIQVMWFRQO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-methoxyphenyl)-(1-methyl-6-phenyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrimidin-8-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)-(1-methyl-6-phenyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrimidin-8-yl)methanone?
The IUPAC name of (4-methoxyphenyl)-(1-methyl-6-phenyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrimidin-8-yl)methanone (CID 102242060) is (4-methoxyphenyl)-(1-methyl-6-phenyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrimidin-8-yl)methanone.
What is the SMILES notation for (4-methoxyphenyl)-(1-methyl-6-phenyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrimidin-8-yl)methanone?
The canonical SMILES for (4-methoxyphenyl)-(1-methyl-6-phenyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrimidin-8-yl)methanone is COc1ccc(C(=O)c2cc(-c3ccccc3)n3c2N(C)CCC3)cc1.
What is the InChIKey of (4-methoxyphenyl)-(1-methyl-6-phenyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrimidin-8-yl)methanone?
The InChIKey is LSPOBIQVMWFRQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O2/c1-23-13-6-14-24-20(16-7-4-3-5-8-16)15-19(22(23)24)21(25)17-9-11-18(26-2)12-10-17/h3-5,7-12,15H,6,13-14H2,1-2H3.
What are the key properties of (4-methoxyphenyl)-(1-methyl-6-phenyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrimidin-8-yl)methanone?
(4-methoxyphenyl)-(1-methyl-6-phenyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrimidin-8-yl)methanone has a molecular weight of 346.43 g/mol, XLogP of 4.23, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)-(1-methyl-6-phenyl-3,4-dihydro-2H-pyrrolo[1,2-a]pyrimidin-8-yl)methanone is sourced from PubChem (CID 102242060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).