C20H29F17O3Si3 — CID 102242168
[(E)-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)prop-1-enyl]-methyl-bis(trimethylsilyloxy)silane (PubChem CID 102242168) has the molecular formula C20H29F17O3Si3 and a molecular weight of 724.67 g/mol. Its IUPAC name is [(E)-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)prop-1-enyl]-methyl-bis(trimethylsilyloxy)silane.
| Compound Name | [(E)-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)prop-1-enyl]-methyl-bis(trimethylsilyloxy)silane |
|---|---|
| PubChem CID | 102242168 |
| Molecular Formula | C20H29F17O3Si3 |
| Molecular Weight | 724.67 g/mol |
| Exact Mass | 724.12 |
| IUPAC Name | [(E)-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)prop-1-enyl]-methyl-bis(trimethylsilyloxy)silane |
| SMILES | C[Si](C)(C)O[Si](C)(/C=C/COCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O[Si](C)(C)C |
| InChI | InChI=1S/C20H29F17O3Si3/c1-41(2,3)39-43(7,40-42(4,5)6)12-8-10-38-11-9-13(21,22)14(23,24)15(25,26)16(27,28)17(29,30)18(31,32)19(33,34)20(35,36)37/h8,12H,9-11H2,1-7H3/b12-8+ |
| InChIKey | FNVDBMKHIQZTFX-XYOKQWHBSA-N |
| XLogP | 9.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.67 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|