C26H23N3O3 — CID 10224257
5-[3-[3-(naphthalen-2-ylmethyl)-1,2,4-oxadiazol-5-yl]indol-1-yl]pentanoic acid (PubChem CID 10224257) has the molecular formula C26H23N3O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is 5-[3-[3-(naphthalen-2-ylmethyl)-1,2,4-oxadiazol-5-yl]indol-1-yl]pentanoic acid.
| Compound Name | 5-[3-[3-(naphthalen-2-ylmethyl)-1,2,4-oxadiazol-5-yl]indol-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 10224257 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 5-[3-[3-(naphthalen-2-ylmethyl)-1,2,4-oxadiazol-5-yl]indol-1-yl]pentanoic acid |
| SMILES | O=C(O)CCCCn1cc(-c2nc(Cc3ccc4ccccc4c3)no2)c2ccccc21 |
| InChI | InChI=1S/C26H23N3O3/c30-25(31)11-5-6-14-29-17-22(21-9-3-4-10-23(21)29)26-27-24(28-32-26)16-18-12-13-19-7-1-2-8-20(19)15-18/h1-4,7-10,12-13,15,17H,5-6,11,14,16H2,(H,30,31) |
| InChIKey | SMQGVBMMLONICI-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|