C20H24O9 — CID 102242816
methyl (2E,4E)-5-[2,2-dimethyl-5-[(4R,6S)-2-oxo-6-(5-oxo-2H-furan-2-yl)-1,3-dioxan-4-yl]-1,3-dioxan-5-yl]penta-2,4-dienoate (PubChem CID 102242816) has the molecular formula C20H24O9 and a molecular weight of 408.40 g/mol. Its IUPAC name is methyl (2E,4E)-5-[2,2-dimethyl-5-[(4R,6S)-2-oxo-6-(5-oxo-2H-furan-2-yl)-1,3-dioxan-4-yl]-1,3-dioxan-5-yl]penta-2,4-dienoate.
| Compound Name | methyl (2E,4E)-5-[2,2-dimethyl-5-[(4R,6S)-2-oxo-6-(5-oxo-2H-furan-2-yl)-1,3-dioxan-4-yl]-1,3-dioxan-5-yl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 102242816 |
| Molecular Formula | C20H24O9 |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | methyl (2E,4E)-5-[2,2-dimethyl-5-[(4R,6S)-2-oxo-6-(5-oxo-2H-furan-2-yl)-1,3-dioxan-4-yl]-1,3-dioxan-5-yl]penta-2,4-dienoate |
| SMILES | COC(=O)/C=C/C=C/C1([C@H]2C[C@@H](C3C=CC(=O)O3)OC(=O)O2)COC(C)(C)OC1 |
| InChI | InChI=1S/C20H24O9/c1-19(2)25-11-20(12-26-19,9-5-4-6-16(21)24-3)15-10-14(28-18(23)29-15)13-7-8-17(22)27-13/h4-9,13-15H,10-12H2,1-3H3/b6-4+,9-5+/t13?,14-,15+/m0/s1 |
| InChIKey | ORIWUMPRKWQNIR-AVRQXOGSSA-N |
| XLogP | 1.82 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|