C21H26O9 — CID 102242817
ethyl (2E,4E)-5-[2,2-dimethyl-5-[(4R,6S)-2-oxo-6-(5-oxo-2H-furan-2-yl)-1,3-dioxan-4-yl]-1,3-dioxan-5-yl]penta-2,4-dienoate (PubChem CID 102242817) has the molecular formula C21H26O9 and a molecular weight of 422.43 g/mol. Its IUPAC name is ethyl (2E,4E)-5-[2,2-dimethyl-5-[(4R,6S)-2-oxo-6-(5-oxo-2H-furan-2-yl)-1,3-dioxan-4-yl]-1,3-dioxan-5-yl]penta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-[2,2-dimethyl-5-[(4R,6S)-2-oxo-6-(5-oxo-2H-furan-2-yl)-1,3-dioxan-4-yl]-1,3-dioxan-5-yl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 102242817 |
| Molecular Formula | C21H26O9 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | ethyl (2E,4E)-5-[2,2-dimethyl-5-[(4R,6S)-2-oxo-6-(5-oxo-2H-furan-2-yl)-1,3-dioxan-4-yl]-1,3-dioxan-5-yl]penta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C=C/C1([C@H]2C[C@@H](C3C=CC(=O)O3)OC(=O)O2)COC(C)(C)OC1 |
| InChI | InChI=1S/C21H26O9/c1-4-25-17(22)7-5-6-10-21(12-26-20(2,3)27-13-21)16-11-15(29-19(24)30-16)14-8-9-18(23)28-14/h5-10,14-16H,4,11-13H2,1-3H3/b7-5+,10-6+/t14?,15-,16+/m0/s1 |
| InChIKey | LQUSOUVAOYTHKN-ZLBGYACQSA-N |
| XLogP | 2.21 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|