C17H20N2 — CID 102243655
(1R,13R)-6,7,14,14-tetramethyl-3,10-diazatetracyclo[11.1.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene (PubChem CID 102243655) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is (1R,13R)-6,7,14,14-tetramethyl-3,10-diazatetracyclo[11.1.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene.
| Compound Name | (1R,13R)-6,7,14,14-tetramethyl-3,10-diazatetracyclo[11.1.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene |
|---|---|
| PubChem CID | 102243655 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (1R,13R)-6,7,14,14-tetramethyl-3,10-diazatetracyclo[11.1.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene |
| SMILES | Cc1cc2nc3c(nc2cc1C)[C@@H]1C[C@H](C3)C1(C)C |
| InChI | InChI=1S/C17H20N2/c1-9-5-13-14(6-10(9)2)19-16-12-7-11(17(12,3)4)8-15(16)18-13/h5-6,11-12H,7-8H2,1-4H3/t11-,12+/m1/s1 |
| InChIKey | MVTJMFWYQZRQOL-NEPJUHHUSA-N |
| XLogP | 3.93 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |