About 5-(dimethylamino)-3,5-dimethylcyclohex-2-en-1-one
5-(dimethylamino)-3,5-dimethylcyclohex-2-en-1-one (PubChem CID 102244152) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 5-(dimethylamino)-3,5-dimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 5-(dimethylamino)-3,5-dimethylcyclohex-2-en-1-one |
| PubChem CID | 102244152 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 5-(dimethylamino)-3,5-dimethylcyclohex-2-en-1-one |
| SMILES | CC1=CC(=O)CC(C)(N(C)C)C1 |
| InChI | InChI=1S/C10H17NO/c1-8-5-9(12)7-10(2,6-8)11(3)4/h5H,6-7H2,1-4H3 |
| InChIKey | HWAKUVSGHHEJFO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(dimethylamino)-3,5-dimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dimethylamino)-3,5-dimethylcyclohex-2-en-1-one?
The IUPAC name of 5-(dimethylamino)-3,5-dimethylcyclohex-2-en-1-one (CID 102244152) is 5-(dimethylamino)-3,5-dimethylcyclohex-2-en-1-one.
What is the SMILES notation for 5-(dimethylamino)-3,5-dimethylcyclohex-2-en-1-one?
The canonical SMILES for 5-(dimethylamino)-3,5-dimethylcyclohex-2-en-1-one is CC1=CC(=O)CC(C)(N(C)C)C1.
What is the InChIKey of 5-(dimethylamino)-3,5-dimethylcyclohex-2-en-1-one?
The InChIKey is HWAKUVSGHHEJFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-8-5-9(12)7-10(2,6-8)11(3)4/h5H,6-7H2,1-4H3.
What are the key properties of 5-(dimethylamino)-3,5-dimethylcyclohex-2-en-1-one?
5-(dimethylamino)-3,5-dimethylcyclohex-2-en-1-one has a molecular weight of 167.25 g/mol, XLogP of 1.62, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dimethylamino)-3,5-dimethylcyclohex-2-en-1-one is sourced from PubChem (CID 102244152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).