C14H26O3 — CID 102244272
(1S)-1-[(6R)-6-(ethoxymethoxy)cyclohexen-1-yl]-2,2-dimethylpropan-1-ol (PubChem CID 102244272) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is (1S)-1-[(6R)-6-(ethoxymethoxy)cyclohexen-1-yl]-2,2-dimethylpropan-1-ol.
| Compound Name | (1S)-1-[(6R)-6-(ethoxymethoxy)cyclohexen-1-yl]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 102244272 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | (1S)-1-[(6R)-6-(ethoxymethoxy)cyclohexen-1-yl]-2,2-dimethylpropan-1-ol |
| SMILES | CCOCO[C@@H]1CCCC=C1[C@@H](O)C(C)(C)C |
| InChI | InChI=1S/C14H26O3/c1-5-16-10-17-12-9-7-6-8-11(12)13(15)14(2,3)4/h8,12-13,15H,5-7,9-10H2,1-4H3/t12-,13-/m1/s1 |
| InChIKey | QQPIWSCNDVOLQV-CHWSQXEVSA-N |
| XLogP | 2.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|