C66H72 — CID 102244452
1,1,2,2,9,9,10,10,16,16,17,17,23,23,24,24,30,30,31,31,37,37,38,38-tetracosamethylhexaspiro[2.4.28.4.215.4.222.4.229.4.236.43]dotetraconta-4,6,11,13,18,20,25,27,32,34,39,41-dodecayne (PubChem CID 102244452) has the molecular formula C66H72 and a molecular weight of 865.30 g/mol. Its IUPAC name is 1,1,2,2,9,9,10,10,16,16,17,17,23,23,24,24,30,30,31,31,37,37,38,38-tetracosamethylhexaspiro[2.4.28.4.215.4.222.4.229.4.236.43]dotetraconta-4,6,11,13,18,20,25,27,32,34,39,41-dodecayne.
| Compound Name | 1,1,2,2,9,9,10,10,16,16,17,17,23,23,24,24,30,30,31,31,37,37,38,38-tetracosamethylhexaspiro[2.4.28.4.215.4.222.4.229.4.236.43]dotetraconta-4,6,11,13,18,20,25,27,32,34,39,41-dodecayne |
|---|---|
| PubChem CID | 102244452 |
| Molecular Formula | C66H72 |
| Molecular Weight | 865.30 g/mol |
| Exact Mass | 864.56 |
| IUPAC Name | 1,1,2,2,9,9,10,10,16,16,17,17,23,23,24,24,30,30,31,31,37,37,38,38-tetracosamethylhexaspiro[2.4.28.4.215.4.222.4.229.4.236.43]dotetraconta-4,6,11,13,18,20,25,27,32,34,39,41-dodecayne |
| SMILES | CC1(C)C(C)(C)C12C#CC#CC1(C#CC#CC3(C#CC#CC4(C#CC#CC5(C#CC#CC6(C#CC#C2)C(C)(C)C6(C)C)C(C)(C)C5(C)C)C(C)(C)C4(C)C)C(C)(C)C3(C)C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C66H72/c1-49(2)50(3,4)61(49)37-25-27-39-62(51(5,6)52(62,7)8)41-29-31-43-64(55(13,14)56(64,15)16)45-33-35-47-66(59(21,22)60(66,23)24)48-36-34-46-65(57(17,18)58(65,19)20)44-32-30-42-63(40-28-26-38-61)53(9,10)54(63,11)12/h1-24H3 |
| InChIKey | WFBPNUSRXKXCAH-UHFFFAOYSA-N |
| XLogP | 12.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.30 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|