C31H36N4 — CID 102244569
5,12-ditert-butyl-3,10-diphenyl-3,4,10,11-tetrazatetracyclo[6.6.1.02,6.09,13]pentadeca-2(6),4,9(13),11-tetraene (PubChem CID 102244569) has the molecular formula C31H36N4 and a molecular weight of 464.66 g/mol. Its IUPAC name is 5,12-ditert-butyl-3,10-diphenyl-3,4,10,11-tetrazatetracyclo[6.6.1.02,6.09,13]pentadeca-2(6),4,9(13),11-tetraene.
| Compound Name | 5,12-ditert-butyl-3,10-diphenyl-3,4,10,11-tetrazatetracyclo[6.6.1.02,6.09,13]pentadeca-2(6),4,9(13),11-tetraene |
|---|---|
| PubChem CID | 102244569 |
| Molecular Formula | C31H36N4 |
| Molecular Weight | 464.66 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | 5,12-ditert-butyl-3,10-diphenyl-3,4,10,11-tetrazatetracyclo[6.6.1.02,6.09,13]pentadeca-2(6),4,9(13),11-tetraene |
| SMILES | CC(C)(C)c1nn(-c2ccccc2)c2c1CC1CC2Cc2c(C(C)(C)C)nn(-c3ccccc3)c21 |
| InChI | InChI=1S/C31H36N4/c1-30(2,3)28-24-18-20-17-21(26(24)34(32-28)22-13-9-7-10-14-22)19-25-27(20)35(23-15-11-8-12-16-23)33-29(25)31(4,5)6/h7-16,20-21H,17-19H2,1-6H3 |
| InChIKey | ZKLVPCPJNZEEEF-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.66 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |