C24H24N2O8 — CID 102244841
pent-4-enyl 2-[1,3,5,7-tetraoxo-2-(2-oxo-2-pent-4-enoxyethyl)pyrrolo[3,4-f]isoindol-6-yl]acetate (PubChem CID 102244841) has the molecular formula C24H24N2O8 and a molecular weight of 468.46 g/mol. Its IUPAC name is pent-4-enyl 2-[1,3,5,7-tetraoxo-2-(2-oxo-2-pent-4-enoxyethyl)pyrrolo[3,4-f]isoindol-6-yl]acetate.
| Compound Name | pent-4-enyl 2-[1,3,5,7-tetraoxo-2-(2-oxo-2-pent-4-enoxyethyl)pyrrolo[3,4-f]isoindol-6-yl]acetate |
|---|---|
| PubChem CID | 102244841 |
| Molecular Formula | C24H24N2O8 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | pent-4-enyl 2-[1,3,5,7-tetraoxo-2-(2-oxo-2-pent-4-enoxyethyl)pyrrolo[3,4-f]isoindol-6-yl]acetate |
| SMILES | C=CCCCOC(=O)Cn1c(=O)c2cc3c(=O)n(CC(=O)OCCCC=C)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C24H24N2O8/c1-3-5-7-9-33-19(27)13-25-21(29)15-11-17-18(12-16(15)22(25)30)24(32)26(23(17)31)14-20(28)34-10-8-6-4-2/h3-4,11-12H,1-2,5-10,13-14H2 |
| InChIKey | PMYGECRZYZFHLZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 130.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|