About methyl (3R,5R)-3,5-dihydroxycyclohexene-1-carboxylate
methyl (3R,5R)-3,5-dihydroxycyclohexene-1-carboxylate (PubChem CID 102245358) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is methyl (3R,5R)-3,5-dihydroxycyclohexene-1-carboxylate.
Molecular Properties
| Compound Name | methyl (3R,5R)-3,5-dihydroxycyclohexene-1-carboxylate |
| PubChem CID | 102245358 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | methyl (3R,5R)-3,5-dihydroxycyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=C[C@H](O)C[C@H](O)C1 |
| InChI | InChI=1S/C8H12O4/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2,6-7,9-10H,3-4H2,1H3/t6-,7+/m0/s1 |
| InChIKey | FEFNGZXKDZBHPZ-NKWVEPMBSA-N |
| XLogP | -0.40 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (3R,5R)-3,5-dihydroxycyclohexene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3R,5R)-3,5-dihydroxycyclohexene-1-carboxylate?
The IUPAC name of methyl (3R,5R)-3,5-dihydroxycyclohexene-1-carboxylate (CID 102245358) is methyl (3R,5R)-3,5-dihydroxycyclohexene-1-carboxylate.
What is the SMILES notation for methyl (3R,5R)-3,5-dihydroxycyclohexene-1-carboxylate?
The canonical SMILES for methyl (3R,5R)-3,5-dihydroxycyclohexene-1-carboxylate is COC(=O)C1=C[C@H](O)C[C@H](O)C1.
What is the InChIKey of methyl (3R,5R)-3,5-dihydroxycyclohexene-1-carboxylate?
The InChIKey is FEFNGZXKDZBHPZ-NKWVEPMBSA-N. The full InChI is InChI=1S/C8H12O4/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2,6-7,9-10H,3-4H2,1H3/t6-,7+/m0/s1.
What are the key properties of methyl (3R,5R)-3,5-dihydroxycyclohexene-1-carboxylate?
methyl (3R,5R)-3,5-dihydroxycyclohexene-1-carboxylate has a molecular weight of 172.18 g/mol, XLogP of -0.40, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3R,5R)-3,5-dihydroxycyclohexene-1-carboxylate is sourced from PubChem (CID 102245358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).