C12H19NO — CID 102245479
(1S,6R,7R)-N,N-diethylbicyclo[4.1.0]hept-2-ene-7-carboxamide (PubChem CID 102245479) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (1S,6R,7R)-N,N-diethylbicyclo[4.1.0]hept-2-ene-7-carboxamide.
| Compound Name | (1S,6R,7R)-N,N-diethylbicyclo[4.1.0]hept-2-ene-7-carboxamide |
|---|---|
| PubChem CID | 102245479 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (1S,6R,7R)-N,N-diethylbicyclo[4.1.0]hept-2-ene-7-carboxamide |
| SMILES | CCN(CC)C(=O)[C@H]1[C@H]2C=CCC[C@H]21 |
| InChI | InChI=1S/C12H19NO/c1-3-13(4-2)12(14)11-9-7-5-6-8-10(9)11/h5,7,9-11H,3-4,6,8H2,1-2H3/t9-,10+,11-/m0/s1 |
| InChIKey | AJHKNYNKQMAKQA-AXFHLTTASA-N |
| XLogP | 2.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|