C17H22O5 — CID 102245627
(3aR,6S,7R,7aS)-6-methoxy-2,2-dimethyl-4-methylidene-7-phenylmethoxy-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran (PubChem CID 102245627) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is (3aR,6S,7R,7aS)-6-methoxy-2,2-dimethyl-4-methylidene-7-phenylmethoxy-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran.
| Compound Name | (3aR,6S,7R,7aS)-6-methoxy-2,2-dimethyl-4-methylidene-7-phenylmethoxy-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran |
|---|---|
| PubChem CID | 102245627 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (3aR,6S,7R,7aS)-6-methoxy-2,2-dimethyl-4-methylidene-7-phenylmethoxy-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran |
| SMILES | C=C1O[C@H](OC)[C@H](OCc2ccccc2)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C17H22O5/c1-11-13-14(22-17(2,3)21-13)15(16(18-4)20-11)19-10-12-8-6-5-7-9-12/h5-9,13-16H,1,10H2,2-4H3/t13-,14-,15+,16-/m0/s1 |
| InChIKey | OIMKGBGOCZOCIA-JONQDZQNSA-N |
| XLogP | 2.61 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |