C24H32N2O6P2 — CID 102245838
2,5-bis(diethoxyphosphoryl)-3,6-diphenyl-2,5-dihydropyrazine (PubChem CID 102245838) has the molecular formula C24H32N2O6P2 and a molecular weight of 506.48 g/mol. Its IUPAC name is 2,5-bis(diethoxyphosphoryl)-3,6-diphenyl-2,5-dihydropyrazine.
| Compound Name | 2,5-bis(diethoxyphosphoryl)-3,6-diphenyl-2,5-dihydropyrazine |
|---|---|
| PubChem CID | 102245838 |
| Molecular Formula | C24H32N2O6P2 |
| Molecular Weight | 506.48 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 2,5-bis(diethoxyphosphoryl)-3,6-diphenyl-2,5-dihydropyrazine |
| SMILES | CCOP(=O)(OCC)C1N=C(c2ccccc2)C(P(=O)(OCC)OCC)N=C1c1ccccc1 |
| InChI | InChI=1S/C24H32N2O6P2/c1-5-29-33(27,30-6-2)23-21(19-15-11-9-12-16-19)26-24(34(28,31-7-3)32-8-4)22(25-23)20-17-13-10-14-18-20/h9-18,23-24H,5-8H2,1-4H3 |
| InChIKey | UFPPZCADPMWGSB-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.48 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|