C7H10S2 — CID 102246052
bicyclo[2.2.1]hept-5-ene-2,3-dithiol (PubChem CID 102246052) has the molecular formula C7H10S2 and a molecular weight of 158.29 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-5-ene-2,3-dithiol.
| Compound Name | bicyclo[2.2.1]hept-5-ene-2,3-dithiol |
|---|---|
| PubChem CID | 102246052 |
| Molecular Formula | C7H10S2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.02 |
| IUPAC Name | bicyclo[2.2.1]hept-5-ene-2,3-dithiol |
| SMILES | SC1C2C=CC(C2)C1S |
| InChI | InChI=1S/C7H10S2/c8-6-4-1-2-5(3-4)7(6)9/h1-2,4-9H,3H2 |
| InChIKey | SFBXVLGAKHXXGL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|