C15H18N4O2 — CID 102246126
(1S,9R,10S,14R)-4-tert-butyl-12-methyl-3,4,5,12-tetrazatetracyclo[7.5.0.02,6.010,14]tetradeca-2,5,7-triene-11,13-dione (PubChem CID 102246126) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is (1S,9R,10S,14R)-4-tert-butyl-12-methyl-3,4,5,12-tetrazatetracyclo[7.5.0.02,6.010,14]tetradeca-2,5,7-triene-11,13-dione.
| Compound Name | (1S,9R,10S,14R)-4-tert-butyl-12-methyl-3,4,5,12-tetrazatetracyclo[7.5.0.02,6.010,14]tetradeca-2,5,7-triene-11,13-dione |
|---|---|
| PubChem CID | 102246126 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (1S,9R,10S,14R)-4-tert-butyl-12-methyl-3,4,5,12-tetrazatetracyclo[7.5.0.02,6.010,14]tetradeca-2,5,7-triene-11,13-dione |
| SMILES | CN1C(=O)[C@H]2[C@@H]3C=Cc4nn(C(C)(C)C)nc4[C@@H]3[C@H]2C1=O |
| InChI | InChI=1S/C15H18N4O2/c1-15(2,3)19-16-8-6-5-7-9(12(8)17-19)11-10(7)13(20)18(4)14(11)21/h5-7,9-11H,1-4H3/t7-,9+,10+,11-/m1/s1 |
| InChIKey | NOVAJQXYASKPQU-GRLWKWRFSA-N |
| XLogP | 1.00 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|