C13H25O4P — CID 102246290
[(Z)-3-cyclohexylprop-2-enyl] diethyl phosphate (PubChem CID 102246290) has the molecular formula C13H25O4P and a molecular weight of 276.31 g/mol. Its IUPAC name is [(Z)-3-cyclohexylprop-2-enyl] diethyl phosphate.
| Compound Name | [(Z)-3-cyclohexylprop-2-enyl] diethyl phosphate |
|---|---|
| PubChem CID | 102246290 |
| Molecular Formula | C13H25O4P |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | [(Z)-3-cyclohexylprop-2-enyl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OC/C=C\C1CCCCC1 |
| InChI | InChI=1S/C13H25O4P/c1-3-15-18(14,16-4-2)17-12-8-11-13-9-6-5-7-10-13/h8,11,13H,3-7,9-10,12H2,1-2H3/b11-8- |
| InChIKey | MSGLOFJPYHJVDK-FLIBITNWSA-N |
| XLogP | 4.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|