C17H35NO2Si2 — CID 102246693
(Z,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylbut-3-enenitrile (PubChem CID 102246693) has the molecular formula C17H35NO2Si2 and a molecular weight of 341.64 g/mol. Its IUPAC name is (Z,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylbut-3-enenitrile.
| Compound Name | (Z,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylbut-3-enenitrile |
|---|---|
| PubChem CID | 102246693 |
| Molecular Formula | C17H35NO2Si2 |
| Molecular Weight | 341.64 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | (Z,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylbut-3-enenitrile |
| SMILES | CC(C)(C)[Si](C)(C)O/C=C\[C@](C)(C#N)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H35NO2Si2/c1-15(2,3)21(8,9)19-13-12-17(7,14-18)20-22(10,11)16(4,5)6/h12-13H,1-11H3/b13-12-/t17-/m1/s1 |
| InChIKey | QWSUGOMNSFHGLF-MUSGIIIZSA-N |
| XLogP | 5.83 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.64 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|