About (Z,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylbut-3-enenitrile
(Z,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylbut-3-enenitrile (PubChem CID 102246693) has the molecular formula C17H35NO2Si2
and a molecular weight of 341.64 g/mol. Its IUPAC name is (Z,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylbut-3-enenitrile.
Molecular Properties
| Compound Name | (Z,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylbut-3-enenitrile |
| PubChem CID | 102246693 |
| Molecular Formula | C17H35NO2Si2 |
| Molecular Weight | 341.64 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | (Z,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylbut-3-enenitrile |
| SMILES | CC(C)(C)[Si](C)(C)O/C=C\[C@](C)(C#N)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H35NO2Si2/c1-15(2,3)21(8,9)19-13-12-17(7,14-18)20-22(10,11)16(4,5)6/h12-13H,1-11H3/b13-12-/t17-/m1/s1 |
| InChIKey | QWSUGOMNSFHGLF-MUSGIIIZSA-N |
| XLogP | 5.83 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.64 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (Z,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylbut-3-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylbut-3-enenitrile?
The IUPAC name of (Z,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylbut-3-enenitrile (CID 102246693) is (Z,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylbut-3-enenitrile.
What is the SMILES notation for (Z,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylbut-3-enenitrile?
The canonical SMILES for (Z,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylbut-3-enenitrile is CC(C)(C)[Si](C)(C)O/C=C\[C@](C)(C#N)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of (Z,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylbut-3-enenitrile?
The InChIKey is QWSUGOMNSFHGLF-MUSGIIIZSA-N. The full InChI is InChI=1S/C17H35NO2Si2/c1-15(2,3)21(8,9)19-13-12-17(7,14-18)20-22(10,11)16(4,5)6/h12-13H,1-11H3/b13-12-/t17-/m1/s1.
What are the key properties of (Z,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylbut-3-enenitrile?
(Z,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylbut-3-enenitrile has a molecular weight of 341.64 g/mol, XLogP of 5.83, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,2R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylbut-3-enenitrile is sourced from PubChem (CID 102246693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).