C13H14O — CID 102247041
(2E,5E)-1-phenylhepta-2,5-dien-4-one (PubChem CID 102247041) has the molecular formula C13H14O and a molecular weight of 186.25 g/mol. Its IUPAC name is (2E,5E)-1-phenylhepta-2,5-dien-4-one.
| Compound Name | (2E,5E)-1-phenylhepta-2,5-dien-4-one |
|---|---|
| PubChem CID | 102247041 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | (2E,5E)-1-phenylhepta-2,5-dien-4-one |
| SMILES | C/C=C/C(=O)/C=C/Cc1ccccc1 |
| InChI | InChI=1S/C13H14O/c1-2-7-13(14)11-6-10-12-8-4-3-5-9-12/h2-9,11H,10H2,1H3/b7-2+,11-6+ |
| InChIKey | VAHZNLRBHIEISL-UDJJJKJKSA-N |
| XLogP | 2.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|