C13H20N2O2 — CID 102247177
(2R)-2-(1-acetyl-3,4-dihydro-2H-pyridin-5-yl)piperidine-1-carbaldehyde (PubChem CID 102247177) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is (2R)-2-(1-acetyl-3,4-dihydro-2H-pyridin-5-yl)piperidine-1-carbaldehyde.
| Compound Name | (2R)-2-(1-acetyl-3,4-dihydro-2H-pyridin-5-yl)piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 102247177 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | (2R)-2-(1-acetyl-3,4-dihydro-2H-pyridin-5-yl)piperidine-1-carbaldehyde |
| SMILES | CC(=O)N1C=C([C@H]2CCCCN2C=O)CCC1 |
| InChI | InChI=1S/C13H20N2O2/c1-11(17)14-8-4-5-12(9-14)13-6-2-3-7-15(13)10-16/h9-10,13H,2-8H2,1H3/t13-/m1/s1 |
| InChIKey | IDRBUUNZHYXUPN-CYBMUJFWSA-N |
| XLogP | 1.52 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|