C15H16O5 — CID 102247238
[(1R,5S,8R,9S)-9-methyl-11-oxo-10,14-dioxatetracyclo[7.2.2.15,8.01,5]tetradeca-6,12-dien-12-yl] acetate (PubChem CID 102247238) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is [(1R,5S,8R,9S)-9-methyl-11-oxo-10,14-dioxatetracyclo[7.2.2.15,8.01,5]tetradeca-6,12-dien-12-yl] acetate.
| Compound Name | [(1R,5S,8R,9S)-9-methyl-11-oxo-10,14-dioxatetracyclo[7.2.2.15,8.01,5]tetradeca-6,12-dien-12-yl] acetate |
|---|---|
| PubChem CID | 102247238 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | [(1R,5S,8R,9S)-9-methyl-11-oxo-10,14-dioxatetracyclo[7.2.2.15,8.01,5]tetradeca-6,12-dien-12-yl] acetate |
| SMILES | CC(=O)OC1=C[C@]2(C)OC(=O)[C@]13CCC[C@]31C=C[C@H]2O1 |
| InChI | InChI=1S/C15H16O5/c1-9(16)18-11-8-13(2)10-4-7-14(19-10)5-3-6-15(11,14)12(17)20-13/h4,7-8,10H,3,5-6H2,1-2H3/t10-,13+,14+,15+/m1/s1 |
| InChIKey | UTPQMMHRRIQFPS-KJEVXHAQSA-N |
| XLogP | 1.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|